C22H22N4O2 — CID 46982916
[2-(2-methylprop-2-enoxy)phenyl]-(4-pyridin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone (PubChem CID 46982916) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoxy)phenyl]-(4-pyridin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | [2-(2-methylprop-2-enoxy)phenyl]-(4-pyridin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 46982916 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [2-(2-methylprop-2-enoxy)phenyl]-(4-pyridin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone |
| SMILES | C=C(C)COc1ccccc1C(=O)N1CCc2[nH]cnc2C1c1ccccn1 |
| InChI | InChI=1S/C22H22N4O2/c1-15(2)13-28-19-9-4-3-7-16(19)22(27)26-12-10-17-20(25-14-24-17)21(26)18-8-5-6-11-23-18/h3-9,11,14,21H,1,10,12-13H2,2H3,(H,24,25) |
| InChIKey | JDYCNVYYDJQRSO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|