About N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine
N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine (PubChem CID 46983204) has the molecular formula C20H31N5
and a molecular weight of 341.50 g/mol. Its IUPAC name is N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine |
| PubChem CID | 46983204 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine |
| SMILES | CNCCCCNC1CCN(c2ccc(-n3ccnc3C)cc2)CC1 |
| InChI | InChI=1S/C20H31N5/c1-17-22-13-16-25(17)20-7-5-19(6-8-20)24-14-9-18(10-15-24)23-12-4-3-11-21-2/h5-8,13,16,18,21,23H,3-4,9-12,14-15H2,1-2H3 |
| InChIKey | YOGZDYAEXIVCTB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine?
The IUPAC name of N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine (CID 46983204) is N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine.
What is the SMILES notation for N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine?
The canonical SMILES for N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine is CNCCCCNC1CCN(c2ccc(-n3ccnc3C)cc2)CC1.
What is the InChIKey of N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine?
The InChIKey is YOGZDYAEXIVCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N5/c1-17-22-13-16-25(17)20-7-5-19(6-8-20)24-14-9-18(10-15-24)23-12-4-3-11-21-2/h5-8,13,16,18,21,23H,3-4,9-12,14-15H2,1-2H3.
What are the key properties of N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine?
N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine has a molecular weight of 341.50 g/mol, XLogP of 2.74, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-yl]butane-1,4-diamine is sourced from PubChem (CID 46983204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).