C34H30N2O6S — CID 4698360
1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4698360) has the molecular formula C34H30N2O6S and a molecular weight of 594.69 g/mol. Its IUPAC name is 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4698360 |
| Molecular Formula | C34H30N2O6S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2C(=C(O)c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2c2nc(C)c(C(C)=O)s2)cc1 |
| InChI | InChI=1S/C34H30N2O6S/c1-5-17-41-26-13-9-24(10-14-26)29-28(31(39)33(40)36(29)34-35-21(3)32(43-34)22(4)37)30(38)25-11-15-27(16-12-25)42-19-23-8-6-7-20(2)18-23/h5-16,18,29,38H,1,17,19H2,2-4H3 |
| InChIKey | ZFLOBFVNZMRQEB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|