C21H27N5O — CID 46983762
3-[3-[[2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethylamino]methyl]indol-1-yl]propanamide (PubChem CID 46983762) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[3-[[2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethylamino]methyl]indol-1-yl]propanamide.
| Compound Name | 3-[3-[[2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethylamino]methyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 46983762 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3-[3-[[2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethylamino]methyl]indol-1-yl]propanamide |
| SMILES | NC(=O)CCn1cc(CNCCc2n[nH]c3c2CCCC3)c2ccccc21 |
| InChI | InChI=1S/C21H27N5O/c22-21(27)10-12-26-14-15(16-5-2-4-8-20(16)26)13-23-11-9-19-17-6-1-3-7-18(17)24-25-19/h2,4-5,8,14,23H,1,3,6-7,9-13H2,(H2,22,27)(H,24,25) |
| InChIKey | ODWSVPHTFHYCLQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|