C40H42N2O7 — CID 4698448
4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 4698448) has the molecular formula C40H42N2O7 and a molecular weight of 662.78 g/mol. Its IUPAC name is 4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4698448 |
| Molecular Formula | C40H42N2O7 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | 4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2CCCN2CCOCC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H42N2O7/c1-28-8-6-11-30(24-28)27-48-33-15-12-31(13-16-33)38(43)36-37(42(40(45)39(36)44)19-7-18-41-20-22-47-23-21-41)32-14-17-34(35(25-32)46-2)49-26-29-9-4-3-5-10-29/h3-6,8-17,24-25,37,43H,7,18-23,26-27H2,1-2H3 |
| InChIKey | PDHPEZMKXHUJPN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|