C21H23NO2 — CID 46985046
4-[[butan-2-yl(3-phenylprop-2-ynyl)amino]methyl]benzoic acid (PubChem CID 46985046) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[[butan-2-yl(3-phenylprop-2-ynyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[butan-2-yl(3-phenylprop-2-ynyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 46985046 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[[butan-2-yl(3-phenylprop-2-ynyl)amino]methyl]benzoic acid |
| SMILES | CCC(C)N(CC#Cc1ccccc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-3-17(2)22(15-7-10-18-8-5-4-6-9-18)16-19-11-13-20(14-12-19)21(23)24/h4-6,8-9,11-14,17H,3,15-16H2,1-2H3,(H,23,24) |
| InChIKey | VEYLWRMQRAYDBB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|