C17H29N3O2 — CID 46985402
2-butyl-8-(2-ethylbutanoyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 46985402) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-butyl-8-(2-ethylbutanoyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-butyl-8-(2-ethylbutanoyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 46985402 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-butyl-8-(2-ethylbutanoyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CCCCC1=NC2(CCN(C(=O)C(CC)CC)CC2)C(=O)N1 |
| InChI | InChI=1S/C17H29N3O2/c1-4-7-8-14-18-16(22)17(19-14)9-11-20(12-10-17)15(21)13(5-2)6-3/h13H,4-12H2,1-3H3,(H,18,19,22) |
| InChIKey | ICVNIRYHHNVUBC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |