C14H19N5 — CID 46985481
N-cyclobutyl-4-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 46985481) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-cyclobutyl-4-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | N-cyclobutyl-4-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 46985481 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-cyclobutyl-4-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | Cc1nn(C)c(C)c1-c1ccnc(NC2CCC2)n1 |
| InChI | InChI=1S/C14H19N5/c1-9-13(10(2)19(3)18-9)12-7-8-15-14(17-12)16-11-5-4-6-11/h7-8,11H,4-6H2,1-3H3,(H,15,16,17) |
| InChIKey | FNAAPVIEHOAECW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |