C20H30N4 — CID 46985896
N-[(2R)-3-methylbutan-2-yl]-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine (PubChem CID 46985896) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-[(2R)-3-methylbutan-2-yl]-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine.
| Compound Name | N-[(2R)-3-methylbutan-2-yl]-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 46985896 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | N-[(2R)-3-methylbutan-2-yl]-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine |
| SMILES | Cc1nccn1-c1ccc(N2CCC(N[C@H](C)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30N4/c1-15(2)16(3)22-18-9-12-23(13-10-18)19-5-7-20(8-6-19)24-14-11-21-17(24)4/h5-8,11,14-16,18,22H,9-10,12-13H2,1-4H3/t16-/m1/s1 |
| InChIKey | XWJJRDWXAMUSNG-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|