C21H30N4 — CID 46986730
1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[(2-pyrazol-1-ylphenyl)methyl]methanamine (PubChem CID 46986730) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[(2-pyrazol-1-ylphenyl)methyl]methanamine.
| Compound Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[(2-pyrazol-1-ylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 46986730 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[(2-pyrazol-1-ylphenyl)methyl]methanamine |
| SMILES | CN(Cc1ccccc1-n1cccn1)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C21H30N4/c1-23(16-18-9-6-14-24-13-5-4-10-20(18)24)17-19-8-2-3-11-21(19)25-15-7-12-22-25/h2-3,7-8,11-12,15,18,20H,4-6,9-10,13-14,16-17H2,1H3/t18-,20+/m0/s1 |
| InChIKey | SRYDHSUQMLZQGY-AZUAARDMSA-N |
| XLogP | 3.57 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |