C19H25N3O3 — CID 46986736
N-(2-methoxyethyl)-2-(2-methylprop-2-enoxy)-N-[(1-methylpyrazol-4-yl)methyl]benzamide (PubChem CID 46986736) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(2-methylprop-2-enoxy)-N-[(1-methylpyrazol-4-yl)methyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-2-(2-methylprop-2-enoxy)-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46986736 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-(2-methylprop-2-enoxy)-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
| SMILES | C=C(C)COc1ccccc1C(=O)N(CCOC)Cc1cnn(C)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-15(2)14-25-18-8-6-5-7-17(18)19(23)22(9-10-24-4)13-16-11-20-21(3)12-16/h5-8,11-12H,1,9-10,13-14H2,2-4H3 |
| InChIKey | IGBCVOGEFDUSJV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|