About (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol
(3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol (PubChem CID 46987259) has the molecular formula C15H30N2O3S
and a molecular weight of 318.48 g/mol. Its IUPAC name is (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 46987259 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol |
| SMILES | CCN(CC1CCN(C(C)C)CC1)[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C15H30N2O3S/c1-4-16(14-10-21(19,20)11-15(14)18)9-13-5-7-17(8-6-13)12(2)3/h12-15,18H,4-11H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | HERCUWDYETWEJM-GJZGRUSLSA-N |
| XLogP | 0.59 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol (CID 46987259) is (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol is CCN(CC1CCN(C(C)C)CC1)[C@H]1CS(=O)(=O)C[C@@H]1O.
What is the InChIKey of (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
The InChIKey is HERCUWDYETWEJM-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H30N2O3S/c1-4-16(14-10-21(19,20)11-15(14)18)9-13-5-7-17(8-6-13)12(2)3/h12-15,18H,4-11H2,1-3H3/t14-,15-/m0/s1.
What are the key properties of (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
(3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol has a molecular weight of 318.48 g/mol, XLogP of 0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-[ethyl-[(1-propan-2-ylpiperidin-4-yl)methyl]amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 46987259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).