About 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one
4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one (PubChem CID 46987426) has the molecular formula C19H20N6O
and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one |
| PubChem CID | 46987426 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one |
| SMILES | Cc1nn(C)cc1-c1ccnc(N2CCN(c3ccccc3)C(=O)C2)n1 |
| InChI | InChI=1S/C19H20N6O/c1-14-16(12-23(2)22-14)17-8-9-20-19(21-17)24-10-11-25(18(26)13-24)15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | NUNLWIJIKUWICJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one?
The IUPAC name of 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one (CID 46987426) is 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one.
What is the SMILES notation for 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one?
The canonical SMILES for 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one is Cc1nn(C)cc1-c1ccnc(N2CCN(c3ccccc3)C(=O)C2)n1.
What is the InChIKey of 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one?
The InChIKey is NUNLWIJIKUWICJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6O/c1-14-16(12-23(2)22-14)17-8-9-20-19(21-17)24-10-11-25(18(26)13-24)15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3.
What are the key properties of 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one?
4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one has a molecular weight of 348.41 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,3-dimethylpyrazol-4-yl)pyrimidin-2-yl]-1-phenylpiperazin-2-one is sourced from PubChem (CID 46987426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).