C21H23NO4 — CID 46987456
3-[[(3-ethoxyphenyl)methyl-(2-hydroxyethyl)amino]methyl]chromen-4-one (PubChem CID 46987456) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[[(3-ethoxyphenyl)methyl-(2-hydroxyethyl)amino]methyl]chromen-4-one.
| Compound Name | 3-[[(3-ethoxyphenyl)methyl-(2-hydroxyethyl)amino]methyl]chromen-4-one |
|---|---|
| PubChem CID | 46987456 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[[(3-ethoxyphenyl)methyl-(2-hydroxyethyl)amino]methyl]chromen-4-one |
| SMILES | CCOc1cccc(CN(CCO)Cc2coc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C21H23NO4/c1-2-25-18-7-5-6-16(12-18)13-22(10-11-23)14-17-15-26-20-9-4-3-8-19(20)21(17)24/h3-9,12,15,23H,2,10-11,13-14H2,1H3 |
| InChIKey | HLADENYDGOWKPM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |