About 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide
4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide (PubChem CID 46987458) has the molecular formula C16H19ClN4O3
and a molecular weight of 350.81 g/mol. Its IUPAC name is 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide |
| PubChem CID | 46987458 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1cc(Cl)ccc1C(=O)N(C)Cc1noc(CC)n1 |
| InChI | InChI=1S/C16H19ClN4O3/c1-4-14(22)18-12-8-10(17)6-7-11(12)16(23)21(3)9-13-19-15(5-2)24-20-13/h6-8H,4-5,9H2,1-3H3,(H,18,22) |
| InChIKey | IXYINOYEPJPUJD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide?
The IUPAC name of 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide (CID 46987458) is 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide.
What is the SMILES notation for 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide?
The canonical SMILES for 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide is CCC(=O)Nc1cc(Cl)ccc1C(=O)N(C)Cc1noc(CC)n1.
What is the InChIKey of 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide?
The InChIKey is IXYINOYEPJPUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O3/c1-4-14(22)18-12-8-10(17)6-7-11(12)16(23)21(3)9-13-19-15(5-2)24-20-13/h6-8H,4-5,9H2,1-3H3,(H,18,22).
What are the key properties of 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide?
4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide has a molecular weight of 350.81 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(propanoylamino)benzamide is sourced from PubChem (CID 46987458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).