C20H24N6O — CID 46987468
5-[1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-3-yl]-3-pyridin-3-yl-1,2,4-oxadiazole (PubChem CID 46987468) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-[1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-3-yl]-3-pyridin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-[1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-3-yl]-3-pyridin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46987468 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 5-[1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-3-yl]-3-pyridin-3-yl-1,2,4-oxadiazole |
| SMILES | C=CCn1cc(CN2CCCC(c3nc(-c4cccnc4)no3)C2)c(C)n1 |
| InChI | InChI=1S/C20H24N6O/c1-3-9-26-14-18(15(2)23-26)13-25-10-5-7-17(12-25)20-22-19(24-27-20)16-6-4-8-21-11-16/h3-4,6,8,11,14,17H,1,5,7,9-10,12-13H2,2H3 |
| InChIKey | LFSNBPMFJYECOK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|