C19H25ClN2O3 — CID 46987569
N-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-6-oxo-1-prop-2-enylpiperidine-3-carboxamide (PubChem CID 46987569) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-6-oxo-1-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-6-oxo-1-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46987569 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-6-oxo-1-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCN1CC(C(=O)N(CC)Cc2cc(Cl)ccc2OC)CCC1=O |
| InChI | InChI=1S/C19H25ClN2O3/c1-4-10-22-12-14(6-9-18(22)23)19(24)21(5-2)13-15-11-16(20)7-8-17(15)25-3/h4,7-8,11,14H,1,5-6,9-10,12-13H2,2-3H3 |
| InChIKey | FWGZPCABLWDUCR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|