C17H22N4O2 — CID 46987909
N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-3-(2-methylprop-2-enoxy)benzamide (PubChem CID 46987909) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-3-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-3-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 46987909 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]-3-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1cccc(C(=O)NCCc2nncn2CC)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-4-21-12-19-20-16(21)8-9-18-17(22)14-6-5-7-15(10-14)23-11-13(2)3/h5-7,10,12H,2,4,8-9,11H2,1,3H3,(H,18,22) |
| InChIKey | LTXOQDKEPMJMHX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|