C20H28N4O — CID 46988214
(1R,9aR)-1-[[(2-pyrazol-1-ylphenyl)methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46988214) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (1R,9aR)-1-[[(2-pyrazol-1-ylphenyl)methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[(2-pyrazol-1-ylphenyl)methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46988214 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (1R,9aR)-1-[[(2-pyrazol-1-ylphenyl)methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | O[C@@]1(CNCc2ccccc2-n2cccn2)CCCN2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H28N4O/c25-20(10-5-13-23-12-4-3-9-19(20)23)16-21-15-17-7-1-2-8-18(17)24-14-6-11-22-24/h1-2,6-8,11,14,19,21,25H,3-5,9-10,12-13,15-16H2/t19-,20-/m1/s1 |
| InChIKey | WXVAARRQALIVOT-WOJBJXKFSA-N |
| XLogP | 2.34 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |