C21H23N7O — CID 46988276
2-[2-methyl-3-[[2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethylamino]methyl]indol-1-yl]acetamide (PubChem CID 46988276) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[2-methyl-3-[[2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethylamino]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[2-methyl-3-[[2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethylamino]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 46988276 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[2-methyl-3-[[2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethylamino]methyl]indol-1-yl]acetamide |
| SMILES | Cc1c(CNCCc2nc(-c3ccncc3)n[nH]2)c2ccccc2n1CC(N)=O |
| InChI | InChI=1S/C21H23N7O/c1-14-17(16-4-2-3-5-18(16)28(14)13-19(22)29)12-24-11-8-20-25-21(27-26-20)15-6-9-23-10-7-15/h2-7,9-10,24H,8,11-13H2,1H3,(H2,22,29)(H,25,26,27) |
| InChIKey | SICIFXRXKQMMGY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|