C18H23N5O2 — CID 46988352
[4-[[3-(2-methylprop-2-enoxy)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 46988352) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is [4-[[3-(2-methylprop-2-enoxy)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | [4-[[3-(2-methylprop-2-enoxy)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 46988352 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [4-[[3-(2-methylprop-2-enoxy)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | C=C(C)COc1cccc(CN2CCN(C(=O)c3ncn[nH]3)CC2)c1 |
| InChI | InChI=1S/C18H23N5O2/c1-14(2)12-25-16-5-3-4-15(10-16)11-22-6-8-23(9-7-22)18(24)17-19-13-20-21-17/h3-5,10,13H,1,6-9,11-12H2,2H3,(H,19,20,21) |
| InChIKey | WFZBYQUNBLQWBL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|