About 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide
2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide (PubChem CID 46988459) has the molecular formula C23H24N2O2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide.
Molecular Properties
| Compound Name | 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide |
| PubChem CID | 46988459 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide |
| SMILES | CCCN(CC#Cc1ccccc1)C(=O)CC1C(=O)Nc2cc(C)ccc21 |
| InChI | InChI=1S/C23H24N2O2/c1-3-13-25(14-7-10-18-8-5-4-6-9-18)22(26)16-20-19-12-11-17(2)15-21(19)24-23(20)27/h4-6,8-9,11-12,15,20H,3,13-14,16H2,1-2H3,(H,24,27) |
| InChIKey | KMVZCJUXPULKDV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide?
The IUPAC name of 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide (CID 46988459) is 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide.
What is the SMILES notation for 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide?
The canonical SMILES for 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide is CCCN(CC#Cc1ccccc1)C(=O)CC1C(=O)Nc2cc(C)ccc21.
What is the InChIKey of 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide?
The InChIKey is KMVZCJUXPULKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O2/c1-3-13-25(14-7-10-18-8-5-4-6-9-18)22(26)16-20-19-12-11-17(2)15-21(19)24-23(20)27/h4-6,8-9,11-12,15,20H,3,13-14,16H2,1-2H3,(H,24,27).
What are the key properties of 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide?
2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide has a molecular weight of 360.46 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)-N-(3-phenylprop-2-ynyl)-N-propylacetamide is sourced from PubChem (CID 46988459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).