C18H30N4O3 — CID 46990800
3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]propanamide (PubChem CID 46990800) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]propanamide.
| Compound Name | 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 46990800 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[[1-(3-methoxypropyl)pyrrolidin-3-yl]methyl]propanamide |
| SMILES | COCCCN1CCC(CNC(=O)CCn2c(C)cc(C)nc2=O)C1 |
| InChI | InChI=1S/C18H30N4O3/c1-14-11-15(2)22(18(24)20-14)9-6-17(23)19-12-16-5-8-21(13-16)7-4-10-25-3/h11,16H,4-10,12-13H2,1-3H3,(H,19,23) |
| InChIKey | OFQLKYCCANVHNX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|