C14H15N3OS — CID 46990875
N-(furan-2-ylmethyl)-N-(1H-imidazol-5-ylmethyl)-1-thiophen-3-ylmethanamine (PubChem CID 46990875) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(1H-imidazol-5-ylmethyl)-1-thiophen-3-ylmethanamine.
| Compound Name | N-(furan-2-ylmethyl)-N-(1H-imidazol-5-ylmethyl)-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 46990875 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(1H-imidazol-5-ylmethyl)-1-thiophen-3-ylmethanamine |
| SMILES | c1coc(CN(Cc2ccsc2)Cc2cnc[nH]2)c1 |
| InChI | InChI=1S/C14H15N3OS/c1-2-14(18-4-1)9-17(7-12-3-5-19-10-12)8-13-6-15-11-16-13/h1-6,10-11H,7-9H2,(H,15,16) |
| InChIKey | VTQOPEIDCWKLJY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |