C19H34N6O2 — CID 46990956
N-hexyl-2-(4-methylpiperazin-1-yl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxamide (PubChem CID 46990956) has the molecular formula C19H34N6O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-hexyl-2-(4-methylpiperazin-1-yl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxamide.
| Compound Name | N-hexyl-2-(4-methylpiperazin-1-yl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxamide |
|---|---|
| PubChem CID | 46990956 |
| Molecular Formula | C19H34N6O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | N-hexyl-2-(4-methylpiperazin-1-yl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxamide |
| SMILES | CCCCCCNC(=O)N1CCC2(CC1)N=C(N1CCN(C)CC1)NC2=O |
| InChI | InChI=1S/C19H34N6O2/c1-3-4-5-6-9-20-18(27)25-10-7-19(8-11-25)16(26)21-17(22-19)24-14-12-23(2)13-15-24/h3-15H2,1-2H3,(H,20,27)(H,21,22,26) |
| InChIKey | MVWUIBGKYHUIRC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|