About N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine
N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine (PubChem CID 46991536) has the molecular formula C17H21N5
and a molecular weight of 295.39 g/mol. Its IUPAC name is N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine |
| PubChem CID | 46991536 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine |
| SMILES | C=CCn1cc(CNCc2cn3cc(C)ccc3n2)c(C)n1 |
| InChI | InChI=1S/C17H21N5/c1-4-7-22-11-15(14(3)20-22)8-18-9-16-12-21-10-13(2)5-6-17(21)19-16/h4-6,10-12,18H,1,7-9H2,2-3H3 |
| InChIKey | OFJNDJRVDBJGOL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine?
The IUPAC name of N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine (CID 46991536) is N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine.
What is the SMILES notation for N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine?
The canonical SMILES for N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine is C=CCn1cc(CNCc2cn3cc(C)ccc3n2)c(C)n1.
What is the InChIKey of N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine?
The InChIKey is OFJNDJRVDBJGOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5/c1-4-7-22-11-15(14(3)20-22)8-18-9-16-12-21-10-13(2)5-6-17(21)19-16/h4-6,10-12,18H,1,7-9H2,2-3H3.
What are the key properties of N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine?
N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine has a molecular weight of 295.39 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine is sourced from PubChem (CID 46991536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).