C19H25N3O2 — CID 46991835
N-[3-(2-ethylphenoxy)propyl]-N,2,4-trimethylpyrimidine-5-carboxamide (PubChem CID 46991835) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[3-(2-ethylphenoxy)propyl]-N,2,4-trimethylpyrimidine-5-carboxamide.
| Compound Name | N-[3-(2-ethylphenoxy)propyl]-N,2,4-trimethylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 46991835 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[3-(2-ethylphenoxy)propyl]-N,2,4-trimethylpyrimidine-5-carboxamide |
| SMILES | CCc1ccccc1OCCCN(C)C(=O)c1cnc(C)nc1C |
| InChI | InChI=1S/C19H25N3O2/c1-5-16-9-6-7-10-18(16)24-12-8-11-22(4)19(23)17-13-20-15(3)21-14(17)2/h6-7,9-10,13H,5,8,11-12H2,1-4H3 |
| InChIKey | XVCHHWNXZKRICN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|