C16H20N4O2S — CID 46991979
methyl (3aS,6aS)-5-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 46991979) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl (3aS,6aS)-5-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-5-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 46991979 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl (3aS,6aS)-5-[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@]12CNC[C@H]1CN(Cc1cccn1-c1nccs1)C2 |
| InChI | InChI=1S/C16H20N4O2S/c1-22-14(21)16-10-17-7-12(16)8-19(11-16)9-13-3-2-5-20(13)15-18-4-6-23-15/h2-6,12,17H,7-11H2,1H3/t12-,16-/m0/s1 |
| InChIKey | HFIMGHSNQXIGGN-LRDDRELGSA-N |
| XLogP | 1.13 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |