C19H31N5O — CID 46992156
(1R,9aR)-1-[[4-(pyrimidin-2-ylamino)piperidin-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46992156) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is (1R,9aR)-1-[[4-(pyrimidin-2-ylamino)piperidin-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[4-(pyrimidin-2-ylamino)piperidin-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46992156 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (1R,9aR)-1-[[4-(pyrimidin-2-ylamino)piperidin-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | O[C@@]1(CN2CCC(Nc3ncccn3)CC2)CCCN2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H31N5O/c25-19(8-3-12-24-11-2-1-5-17(19)24)15-23-13-6-16(7-14-23)22-18-20-9-4-10-21-18/h4,9-10,16-17,25H,1-3,5-8,11-15H2,(H,20,21,22)/t17-,19-/m1/s1 |
| InChIKey | DVACLYGFTNCZSV-IEBWSBKVSA-N |
| XLogP | 1.73 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |