C21H24N2O3 — CID 46992453
[4-[(3-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2,6-dimethylphenyl] acetate (PubChem CID 46992453) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [4-[(3-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2,6-dimethylphenyl] acetate.
| Compound Name | [4-[(3-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2,6-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 46992453 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [4-[(3-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2,6-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(CN2Cc3ccccc3CC2C(N)=O)cc1C |
| InChI | InChI=1S/C21H24N2O3/c1-13-8-16(9-14(2)20(13)26-15(3)24)11-23-12-18-7-5-4-6-17(18)10-19(23)21(22)25/h4-9,19H,10-12H2,1-3H3,(H2,22,25) |
| InChIKey | SSYXKPSVFHXZDP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|