C18H32N2O2 — CID 46992532
(1R,9aR)-1-[[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46992532) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (1R,9aR)-1-[[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46992532 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (1R,9aR)-1-[[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | C=CCC(O)(CC=C)CNC[C@]1(O)CCCN2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H32N2O2/c1-3-9-17(21,10-4-2)14-19-15-18(22)11-7-13-20-12-6-5-8-16(18)20/h3-4,16,19,21-22H,1-2,5-15H2/t16-,18-/m1/s1 |
| InChIKey | BHOKIBANGMZNGA-SJLPKXTDSA-N |
| XLogP | 1.84 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|