About azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone
azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone (PubChem CID 46992558) has the molecular formula C23H27N5O
and a molecular weight of 389.50 g/mol. Its IUPAC name is azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone.
Molecular Properties
| Compound Name | azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone |
| PubChem CID | 46992558 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone |
| SMILES | CNc1ncc(-c2cc(C(=O)N3CCCCCC3)c3c(C)cc(C)cc3n2)cn1 |
| InChI | InChI=1S/C23H27N5O/c1-15-10-16(2)21-18(22(29)28-8-6-4-5-7-9-28)12-19(27-20(21)11-15)17-13-25-23(24-3)26-14-17/h10-14H,4-9H2,1-3H3,(H,24,25,26) |
| InChIKey | GNNSEQZXMCMCQP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone?
The IUPAC name of azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone (CID 46992558) is azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone.
What is the SMILES notation for azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone?
The canonical SMILES for azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone is CNc1ncc(-c2cc(C(=O)N3CCCCCC3)c3c(C)cc(C)cc3n2)cn1.
What is the InChIKey of azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone?
The InChIKey is GNNSEQZXMCMCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N5O/c1-15-10-16(2)21-18(22(29)28-8-6-4-5-7-9-28)12-19(27-20(21)11-15)17-13-25-23(24-3)26-14-17/h10-14H,4-9H2,1-3H3,(H,24,25,26).
What are the key properties of azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone?
azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone has a molecular weight of 389.50 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-[5,7-dimethyl-2-[2-(methylamino)pyrimidin-5-yl]quinolin-4-yl]methanone is sourced from PubChem (CID 46992558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).