C41H33N3O5S2 — CID 4699259
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4699259) has the molecular formula C41H33N3O5S2 and a molecular weight of 711.87 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4699259 |
| Molecular Formula | C41H33N3O5S2 |
| Molecular Weight | 711.87 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccccc1COc1ccc(C(O)=C2C(=O)C(=O)N(c3nnc(SCc4ccccc4)s3)C2c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C41H33N3O5S2/c1-27-10-8-9-15-32(27)25-49-34-22-18-31(19-23-34)37(45)35-36(30-16-20-33(21-17-30)48-24-28-11-4-2-5-12-28)44(39(47)38(35)46)40-42-43-41(51-40)50-26-29-13-6-3-7-14-29/h2-23,36,45H,24-26H2,1H3 |
| InChIKey | SGLGWXMGLPLZKK-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.87 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|