C19H21NOS2 — CID 46992953
3-[5-[[cyclopropyl-[(4-methylsulfanylphenyl)methyl]amino]methyl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 46992953) has the molecular formula C19H21NOS2 and a molecular weight of 343.52 g/mol. Its IUPAC name is 3-[5-[[cyclopropyl-[(4-methylsulfanylphenyl)methyl]amino]methyl]thiophen-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[cyclopropyl-[(4-methylsulfanylphenyl)methyl]amino]methyl]thiophen-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 46992953 |
| Molecular Formula | C19H21NOS2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-[5-[[cyclopropyl-[(4-methylsulfanylphenyl)methyl]amino]methyl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | CSc1ccc(CN(Cc2ccc(C#CCO)s2)C2CC2)cc1 |
| InChI | InChI=1S/C19H21NOS2/c1-22-17-8-4-15(5-9-17)13-20(16-6-7-16)14-19-11-10-18(23-19)3-2-12-21/h4-5,8-11,16,21H,6-7,12-14H2,1H3 |
| InChIKey | FUAYABWSVVCCSA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|