C14H25N5O — CID 46993199
1-(2-cycloheptylethyl)-3-(1-ethyl-1,2,4-triazol-3-yl)urea (PubChem CID 46993199) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-(2-cycloheptylethyl)-3-(1-ethyl-1,2,4-triazol-3-yl)urea.
| Compound Name | 1-(2-cycloheptylethyl)-3-(1-ethyl-1,2,4-triazol-3-yl)urea |
|---|---|
| PubChem CID | 46993199 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 1-(2-cycloheptylethyl)-3-(1-ethyl-1,2,4-triazol-3-yl)urea |
| SMILES | CCn1cnc(NC(=O)NCCC2CCCCCC2)n1 |
| InChI | InChI=1S/C14H25N5O/c1-2-19-11-16-13(18-19)17-14(20)15-10-9-12-7-5-3-4-6-8-12/h11-12H,2-10H2,1H3,(H2,15,17,18,20) |
| InChIKey | QKUYTFKDMDUPFV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |