About 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea
1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 46993215) has the molecular formula C12H13ClN4OS
and a molecular weight of 296.78 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea |
| PubChem CID | 46993215 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | Cc1nsc(NC(=O)NC(C)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H13ClN4OS/c1-7(9-3-5-10(13)6-4-9)14-11(18)16-12-15-8(2)17-19-12/h3-7H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | YCOASZOZBVBEDE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea?
The IUPAC name of 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea (CID 46993215) is 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea.
What is the SMILES notation for 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea?
The canonical SMILES for 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea is Cc1nsc(NC(=O)NC(C)c2ccc(Cl)cc2)n1.
What is the InChIKey of 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea?
The InChIKey is YCOASZOZBVBEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4OS/c1-7(9-3-5-10(13)6-4-9)14-11(18)16-12-15-8(2)17-19-12/h3-7H,1-2H3,(H2,14,15,16,17,18).
What are the key properties of 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea?
1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea has a molecular weight of 296.78 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-chlorophenyl)ethyl]-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea is sourced from PubChem (CID 46993215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).