About N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine
N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine (PubChem CID 46993363) has the molecular formula C20H28N2O2S
and a molecular weight of 360.52 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine |
| PubChem CID | 46993363 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine |
| SMILES | Cc1ccccc1CN(CCN(C)C)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H28N2O2S/c1-17-7-5-6-8-19(17)16-22(14-13-21(2)3)15-18-9-11-20(12-10-18)25(4,23)24/h5-12H,13-16H2,1-4H3 |
| InChIKey | CJFZAWWIVXOODD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine?
The IUPAC name of N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine (CID 46993363) is N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine?
The canonical SMILES for N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine is Cc1ccccc1CN(CCN(C)C)Cc1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine?
The InChIKey is CJFZAWWIVXOODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O2S/c1-17-7-5-6-8-19(17)16-22(14-13-21(2)3)15-18-9-11-20(12-10-18)25(4,23)24/h5-12H,13-16H2,1-4H3.
What are the key properties of N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine?
N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine has a molecular weight of 360.52 g/mol, XLogP of 2.96, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-[(2-methylphenyl)methyl]-N'-[(4-methylsulfonylphenyl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 46993363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).