About 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide
1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide (PubChem CID 46993557) has the molecular formula C17H27N5O3
and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide |
| PubChem CID | 46993557 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(C)n(CCC(=O)NCCN2CCCC(C(N)=O)C2)c(=O)n1 |
| InChI | InChI=1S/C17H27N5O3/c1-12-10-13(2)22(17(25)20-12)8-5-15(23)19-6-9-21-7-3-4-14(11-21)16(18)24/h10,14H,3-9,11H2,1-2H3,(H2,18,24)(H,19,23) |
| InChIKey | UYFZWMRLHMKOQJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide?
The IUPAC name of 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide (CID 46993557) is 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide?
The canonical SMILES for 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide is Cc1cc(C)n(CCC(=O)NCCN2CCCC(C(N)=O)C2)c(=O)n1.
What is the InChIKey of 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide?
The InChIKey is UYFZWMRLHMKOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N5O3/c1-12-10-13(2)22(17(25)20-12)8-5-15(23)19-6-9-21-7-3-4-14(11-21)16(18)24/h10,14H,3-9,11H2,1-2H3,(H2,18,24)(H,19,23).
What are the key properties of 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide?
1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide has a molecular weight of 349.44 g/mol, XLogP of -0.44, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoylamino]ethyl]piperidine-3-carboxamide is sourced from PubChem (CID 46993557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).