About (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine
(E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine (PubChem CID 46993820) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine |
| PubChem CID | 46993820 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine |
| SMILES | C/C(=C\c1ccco1)CN(C)C(C)Cc1cc(C)ccn1 |
| InChI | InChI=1S/C18H24N2O/c1-14-7-8-19-17(10-14)12-16(3)20(4)13-15(2)11-18-6-5-9-21-18/h5-11,16H,12-13H2,1-4H3/b15-11+ |
| InChIKey | NZDKTQXHLOSPPK-RVDMUPIBSA-N |
| XLogP | 3.95 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine?
The IUPAC name of (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine (CID 46993820) is (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine.
What is the SMILES notation for (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine?
The canonical SMILES for (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine is C/C(=C\c1ccco1)CN(C)C(C)Cc1cc(C)ccn1.
What is the InChIKey of (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine?
The InChIKey is NZDKTQXHLOSPPK-RVDMUPIBSA-N. The full InChI is InChI=1S/C18H24N2O/c1-14-7-8-19-17(10-14)12-16(3)20(4)13-15(2)11-18-6-5-9-21-18/h5-11,16H,12-13H2,1-4H3/b15-11+.
What are the key properties of (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine?
(E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine has a molecular weight of 284.40 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(furan-2-yl)-N,2-dimethyl-N-[1-(4-methyl-2-pyridinyl)propan-2-yl]prop-2-en-1-amine is sourced from PubChem (CID 46993820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).