C17H24N2O2 — CID 46994186
1-N'-butyl-1-N'-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 46994186) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-N'-butyl-1-N'-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-butyl-1-N'-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 46994186 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-N'-butyl-1-N'-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | CCCCN(Cc1ccccc1C)C(=O)C1(C(N)=O)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-4-11-19(12-14-8-6-5-7-13(14)2)16(21)17(9-10-17)15(18)20/h5-8H,3-4,9-12H2,1-2H3,(H2,18,20) |
| InChIKey | YTSSJUWQMNBWIJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|