About 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide
4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide (PubChem CID 46995562) has the molecular formula C9H13N5O2S
and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide |
| PubChem CID | 46995562 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide |
| SMILES | Cc1nnc(NC(=O)N2CCN(C)C(=O)C2)s1 |
| InChI | InChI=1S/C9H13N5O2S/c1-6-11-12-8(17-6)10-9(16)14-4-3-13(2)7(15)5-14/h3-5H2,1-2H3,(H,10,12,16) |
| InChIKey | CTHWRPLTQGPDLX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide?
The IUPAC name of 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide (CID 46995562) is 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide.
What is the SMILES notation for 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide?
The canonical SMILES for 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide is Cc1nnc(NC(=O)N2CCN(C)C(=O)C2)s1.
What is the InChIKey of 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide?
The InChIKey is CTHWRPLTQGPDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O2S/c1-6-11-12-8(17-6)10-9(16)14-4-3-13(2)7(15)5-14/h3-5H2,1-2H3,(H,10,12,16).
What are the key properties of 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide?
4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide has a molecular weight of 255.30 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-oxopiperazine-1-carboxamide is sourced from PubChem (CID 46995562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).