C18H24N2O3 — CID 46996215
2-[[2-(2-ethoxyphenoxy)ethyl-methylamino]methyl]-6-methylpyridin-3-ol (PubChem CID 46996215) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[[2-(2-ethoxyphenoxy)ethyl-methylamino]methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[[2-(2-ethoxyphenoxy)ethyl-methylamino]methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 46996215 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-[[2-(2-ethoxyphenoxy)ethyl-methylamino]methyl]-6-methylpyridin-3-ol |
| SMILES | CCOc1ccccc1OCCN(C)Cc1nc(C)ccc1O |
| InChI | InChI=1S/C18H24N2O3/c1-4-22-17-7-5-6-8-18(17)23-12-11-20(3)13-15-16(21)10-9-14(2)19-15/h5-10,21H,4,11-13H2,1-3H3 |
| InChIKey | UQVAQDJLHUOYFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |