C24H22N2O2 — CID 46996709
2-[(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carbonyl]-1H-quinolin-4-one (PubChem CID 46996709) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carbonyl]-1H-quinolin-4-one.
| Compound Name | 2-[(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carbonyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 46996709 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carbonyl]-1H-quinolin-4-one |
| SMILES | C=CC[C@@H]1CC=C[C@@H](c2ccccc2)N1C(=O)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C24H22N2O2/c1-2-9-18-12-8-15-22(17-10-4-3-5-11-17)26(18)24(28)21-16-23(27)19-13-6-7-14-20(19)25-21/h2-8,10-11,13-16,18,22H,1,9,12H2,(H,25,27)/t18-,22+/m1/s1 |
| InChIKey | XHFQOMLMIXFMAH-GCJKJVERSA-N |
| XLogP | 4.62 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|