C23H24N4O — CID 46996756
4-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 46996756) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 4-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 46996756 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | C=CCn1cc(CN2CC(=O)Nc3ccccc3C2c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C23H24N4O/c1-3-13-27-15-19(17(2)25-27)14-26-16-22(28)24-21-12-8-7-11-20(21)23(26)18-9-5-4-6-10-18/h3-12,15,23H,1,13-14,16H2,2H3,(H,24,28) |
| InChIKey | IXDVMJLUYLVLSX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|