C14H17N5O2S — CID 46998064
N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 46998064) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 46998064 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCNC(=O)c1c(NC(=O)c2ncn[nH]2)sc2c1CCCC2 |
| InChI | InChI=1S/C14H17N5O2S/c1-2-15-12(20)10-8-5-3-4-6-9(8)22-14(10)18-13(21)11-16-7-17-19-11/h7H,2-6H2,1H3,(H,15,20)(H,18,21)(H,16,17,19) |
| InChIKey | NSNKFHFJKVUFQX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |