C15H20N8O — CID 46998330
2-[1-[1-(7H-purin-6-yl)piperidin-4-yl]triazol-4-yl]propan-2-ol (PubChem CID 46998330) has the molecular formula C15H20N8O and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[1-[1-(7H-purin-6-yl)piperidin-4-yl]triazol-4-yl]propan-2-ol.
| Compound Name | 2-[1-[1-(7H-purin-6-yl)piperidin-4-yl]triazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 46998330 |
| Molecular Formula | C15H20N8O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[1-[1-(7H-purin-6-yl)piperidin-4-yl]triazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cn(C2CCN(c3ncnc4nc[nH]c34)CC2)nn1 |
| InChI | InChI=1S/C15H20N8O/c1-15(2,24)11-7-23(21-20-11)10-3-5-22(6-4-10)14-12-13(17-8-16-12)18-9-19-14/h7-10,24H,3-6H2,1-2H3,(H,16,17,18,19) |
| InChIKey | XOVKMHUSPNVZQE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |