About 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide
5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 46999797) has the molecular formula C18H27N3O4
and a molecular weight of 349.43 g/mol. Its IUPAC name is 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| PubChem CID | 46999797 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)N(CCOC)Cc2c(C)nn(CC)c2C)o1 |
| InChI | InChI=1S/C18H27N3O4/c1-6-21-14(4)15(13(3)19-21)12-20(10-11-23-5)18(22)16-8-9-17(25-16)24-7-2/h8-9H,6-7,10-12H2,1-5H3 |
| InChIKey | BMTCLQJOPOTUNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide?
The IUPAC name of 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide (CID 46999797) is 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
What is the SMILES notation for 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide?
The canonical SMILES for 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide is CCOc1ccc(C(=O)N(CCOC)Cc2c(C)nn(CC)c2C)o1.
What is the InChIKey of 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide?
The InChIKey is BMTCLQJOPOTUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O4/c1-6-21-14(4)15(13(3)19-21)12-20(10-11-23-5)18(22)16-8-9-17(25-16)24-7-2/h8-9H,6-7,10-12H2,1-5H3.
What are the key properties of 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide?
5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide has a molecular weight of 349.43 g/mol, XLogP of 2.80, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide is sourced from PubChem (CID 46999797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).