C22H30N4O — CID 46999935
(1R,9aR)-1-[[2-(4-phenylpyrimidin-2-yl)ethylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46999935) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (1R,9aR)-1-[[2-(4-phenylpyrimidin-2-yl)ethylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[2-(4-phenylpyrimidin-2-yl)ethylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46999935 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (1R,9aR)-1-[[2-(4-phenylpyrimidin-2-yl)ethylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | O[C@@]1(CNCCc2nccc(-c3ccccc3)n2)CCCN2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H30N4O/c27-22(12-6-16-26-15-5-4-9-20(22)26)17-23-13-11-21-24-14-10-19(25-21)18-7-2-1-3-8-18/h1-3,7-8,10,14,20,23,27H,4-6,9,11-13,15-17H2/t20-,22-/m1/s1 |
| InChIKey | IYHSDVNMVQFJCB-IFMALSPDSA-N |
| XLogP | 2.66 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|