C19H25NO2S — CID 47000020
[2-methoxy-5-[[methyl-[2-(4-methylphenyl)sulfanylethyl]amino]methyl]phenyl]methanol (PubChem CID 47000020) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is [2-methoxy-5-[[methyl-[2-(4-methylphenyl)sulfanylethyl]amino]methyl]phenyl]methanol.
| Compound Name | [2-methoxy-5-[[methyl-[2-(4-methylphenyl)sulfanylethyl]amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 47000020 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [2-methoxy-5-[[methyl-[2-(4-methylphenyl)sulfanylethyl]amino]methyl]phenyl]methanol |
| SMILES | COc1ccc(CN(C)CCSc2ccc(C)cc2)cc1CO |
| InChI | InChI=1S/C19H25NO2S/c1-15-4-7-18(8-5-15)23-11-10-20(2)13-16-6-9-19(22-3)17(12-16)14-21/h4-9,12,21H,10-11,13-14H2,1-3H3 |
| InChIKey | ATDZRPUXULVABJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |