About N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide
N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide (PubChem CID 47000449) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide |
| PubChem CID | 47000449 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide |
| SMILES | CCC(C)N(CC#Cc1ccccc1)C(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C18H19N3O3/c1-3-13(2)21(11-7-10-14-8-5-4-6-9-14)17(23)15-12-16(22)20-18(24)19-15/h4-6,8-9,12-13H,3,11H2,1-2H3,(H2,19,20,22,24) |
| InChIKey | MKZFSAZVHUVJCC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide?
The IUPAC name of N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide (CID 47000449) is N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide.
What is the SMILES notation for N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide?
The canonical SMILES for N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide is CCC(C)N(CC#Cc1ccccc1)C(=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide?
The InChIKey is MKZFSAZVHUVJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3/c1-3-13(2)21(11-7-10-14-8-5-4-6-9-14)17(23)15-12-16(22)20-18(24)19-15/h4-6,8-9,12-13H,3,11H2,1-2H3,(H2,19,20,22,24).
What are the key properties of N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide?
N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide has a molecular weight of 325.37 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2,4-dioxo-N-(3-phenylprop-2-ynyl)-1H-pyrimidine-6-carboxamide is sourced from PubChem (CID 47000449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).